C25H33F3N4O2S — CID 169138813
N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 169138813) has the molecular formula C25H33F3N4O2S and a molecular weight of 510.63 g/mol. Its IUPAC name is N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169138813 |
| Molecular Formula | C25H33F3N4O2S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC2CC(NC(=O)c3cnn(CC(F)(F)F)c3)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H33F3N4O2S/c1-3-20-10-21-22(35-20)4-7-34-24(21)5-6-31(16(2)11-24)13-17-8-19(9-17)30-23(33)18-12-29-32(14-18)15-25(26,27)28/h10,12,14,16-17,19H,3-9,11,13,15H2,1-2H3,(H,30,33)/t16-,17?,19?,24+/m0/s1 |
| InChIKey | PBTXLMZLBGLANG-UQFDQIRFSA-N |
| XLogP | 4.53 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |