C21H28N2OS2 — CID 169139359
4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]-N-methylsulfanylaniline (PubChem CID 169139359) has the molecular formula C21H28N2OS2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]-N-methylsulfanylaniline.
| Compound Name | 4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]-N-methylsulfanylaniline |
|---|---|
| PubChem CID | 169139359 |
| Molecular Formula | C21H28N2OS2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]-N-methylsulfanylaniline |
| SMILES | CCc1cc2c(s1)CCOC21CCN(Cc2ccc(NSC)cc2)CC1 |
| InChI | InChI=1S/C21H28N2OS2/c1-3-18-14-19-20(26-18)8-13-24-21(19)9-11-23(12-10-21)15-16-4-6-17(7-5-16)22-25-2/h4-7,14,22H,3,8-13,15H2,1-2H3 |
| InChIKey | OWQYJYAXJCRGRR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|