C15H15F6NO3S — CID 169139591
2,2,2-trifluoro-1-[(2'S,4S,7R)-4-hydroxy-2'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone (PubChem CID 169139591) has the molecular formula C15H15F6NO3S and a molecular weight of 403.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(2'S,4S,7R)-4-hydroxy-2'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(2'S,4S,7R)-4-hydroxy-2'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone |
|---|---|
| PubChem CID | 169139591 |
| Molecular Formula | C15H15F6NO3S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2,2,2-trifluoro-1-[(2'S,4S,7R)-4-hydroxy-2'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone |
| SMILES | C[C@H]1C[C@@]2(CCN1C(=O)C(F)(F)F)OC[C@@H](O)c1cc(C(F)(F)F)sc12 |
| InChI | InChI=1S/C15H15F6NO3S/c1-7-5-13(2-3-22(7)12(24)15(19,20)21)11-8(9(23)6-25-13)4-10(26-11)14(16,17)18/h4,7,9,23H,2-3,5-6H2,1H3/t7-,9+,13+/m0/s1 |
| InChIKey | JRSUBSIYBAOHEX-WIMUKIRHSA-N |
| XLogP | 3.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |