C19H23BrN2OS — CID 169139849
1'-[(6-bromo-3-pyridinyl)methyl]-2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 169139849) has the molecular formula C19H23BrN2OS and a molecular weight of 407.38 g/mol. Its IUPAC name is 1'-[(6-bromo-3-pyridinyl)methyl]-2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | 1'-[(6-bromo-3-pyridinyl)methyl]-2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 169139849 |
| Molecular Formula | C19H23BrN2OS |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1'-[(6-bromo-3-pyridinyl)methyl]-2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | CCc1cc2c(s1)CCOC21CCN(Cc2ccc(Br)nc2)CC1 |
| InChI | InChI=1S/C19H23BrN2OS/c1-2-15-11-16-17(24-15)5-10-23-19(16)6-8-22(9-7-19)13-14-3-4-18(20)21-12-14/h3-4,11-12H,2,5-10,13H2,1H3 |
| InChIKey | GSSLWNNHINXTKX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|