C21H27F3N4O2S — CID 169139913
3-[[5-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 169139913) has the molecular formula C21H27F3N4O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[[5-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[5-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 169139913 |
| Molecular Formula | C21H27F3N4O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[[5-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cc2c(s1)CCOC21CCN(Cc2cnc(NCC(O)C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C21H27F3N4O2S/c1-2-15-9-16-17(31-15)3-8-30-20(16)4-6-28(7-5-20)13-14-10-25-19(26-11-14)27-12-18(29)21(22,23)24/h9-11,18,29H,2-8,12-13H2,1H3,(H,25,26,27) |
| InChIKey | SXWBWACJRUKBOW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |