C23H34N4O3S — CID 169140109
(2'S,4R)-2-ethyl-2'-methyl-1'-[[1-[(2-methyl-1,4-dioxan-2-yl)methyl]triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 169140109) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-[(2-methyl-1,4-dioxan-2-yl)methyl]triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-[(2-methyl-1,4-dioxan-2-yl)methyl]triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 169140109 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-[(2-methyl-1,4-dioxan-2-yl)methyl]triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(Cc2cn(CC3(C)COCCO3)nn2)[C@@H](C)C1 |
| InChI | InChI=1S/C23H34N4O3S/c1-4-19-11-20-21(31-19)5-8-30-23(20)6-7-26(17(2)12-23)13-18-14-27(25-24-18)15-22(3)16-28-9-10-29-22/h11,14,17H,4-10,12-13,15-16H2,1-3H3/t17-,22?,23+/m0/s1 |
| InChIKey | UVCTUFGKZHPHKG-RBNURNQNSA-N |
| XLogP | 3.16 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |