C22H29F3N4O2S — CID 169140158
3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 169140158) has the molecular formula C22H29F3N4O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is 3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 169140158 |
| Molecular Formula | C22H29F3N4O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]pyrimidin-2-yl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(Cc2cnc(NCC(O)C(F)(F)F)nc2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H29F3N4O2S/c1-3-16-8-17-18(32-16)4-7-31-21(17)5-6-29(14(2)9-21)13-15-10-26-20(27-11-15)28-12-19(30)22(23,24)25/h8,10-11,14,19,30H,3-7,9,12-13H2,1-2H3,(H,26,27,28)/t14-,19?,21+/m0/s1 |
| InChIKey | ZPILQJHQQRUZPX-XTAYQOGCSA-N |
| XLogP | 3.89 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |