C19H24F2N2O2S — CID 169140175
(2'S,7R)-2-(2,2-difluoroethyl)-2'-methyl-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 169140175) has the molecular formula C19H24F2N2O2S and a molecular weight of 382.48 g/mol. Its IUPAC name is (2'S,7R)-2-(2,2-difluoroethyl)-2'-methyl-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,7R)-2-(2,2-difluoroethyl)-2'-methyl-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 169140175 |
| Molecular Formula | C19H24F2N2O2S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2'S,7R)-2-(2,2-difluoroethyl)-2'-methyl-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | Cc1cc(CN2CC[C@]3(C[C@@H]2C)OCCc2cc(CC(F)F)sc23)no1 |
| InChI | InChI=1S/C19H24F2N2O2S/c1-12-10-19(4-5-23(12)11-15-7-13(2)25-22-15)18-14(3-6-24-19)8-16(26-18)9-17(20)21/h7-8,12,17H,3-6,9-11H2,1-2H3/t12-,19+/m0/s1 |
| InChIKey | KGYMEKLAJJOXJC-HXPMCKFVSA-N |
| XLogP | 4.30 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |