C24H34N2OS2 — CID 169140513
N-tert-butylsulfanyl-4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]aniline (PubChem CID 169140513) has the molecular formula C24H34N2OS2 and a molecular weight of 430.68 g/mol. Its IUPAC name is N-tert-butylsulfanyl-4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]aniline.
| Compound Name | N-tert-butylsulfanyl-4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]aniline |
|---|---|
| PubChem CID | 169140513 |
| Molecular Formula | C24H34N2OS2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-tert-butylsulfanyl-4-[(2-ethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methyl]aniline |
| SMILES | CCc1cc2c(s1)CCOC21CCN(Cc2ccc(NSC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H34N2OS2/c1-5-20-16-21-22(28-20)10-15-27-24(21)11-13-26(14-12-24)17-18-6-8-19(9-7-18)25-29-23(2,3)4/h6-9,16,25H,5,10-15,17H2,1-4H3 |
| InChIKey | NFRVVKMBHBYKRT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|