About trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol
trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol (PubChem CID 169141500) has the molecular formula C17H30FN3O
and a molecular weight of 311.45 g/mol. Its IUPAC name is trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol |
| PubChem CID | 169141500 |
| Molecular Formula | C17H30FN3O |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol |
| SMILES | CCC(CC)Nc1cc([C@H]2CC(O)[C@@H](F)C2)nn1C(C)(C)C |
| InChI | InChI=1S/C17H30FN3O/c1-6-12(7-2)19-16-10-14(20-21(16)17(3,4)5)11-8-13(18)15(22)9-11/h10-13,15,19,22H,6-9H2,1-5H3/t11-,13+,15?/m1/s1 |
| InChIKey | UQRWPYNAGHNCGJ-JZHZUCMVSA-N |
| XLogP | 3.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol?
The IUPAC name of trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol (CID 169141500) is trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol.
What is the SMILES notation for trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol?
The canonical SMILES for trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol is CCC(CC)Nc1cc([C@H]2CC(O)[C@@H](F)C2)nn1C(C)(C)C.
What is the InChIKey of trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol?
The InChIKey is UQRWPYNAGHNCGJ-JZHZUCMVSA-N. The full InChI is InChI=1S/C17H30FN3O/c1-6-12(7-2)19-16-10-14(20-21(16)17(3,4)5)11-8-13(18)15(22)9-11/h10-13,15,19,22H,6-9H2,1-5H3/t11-,13+,15?/m1/s1.
What are the key properties of trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol?
trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol has a molecular weight of 311.45 g/mol, XLogP of 3.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,4S)-4-[1-tert-butyl-5-(pentan-3-ylamino)pyrazol-3-yl]-2-fluorocyclopentan-1-ol is sourced from PubChem (CID 169141500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).