C21H21F4N7O3 — CID 169142322
[(3S,4R,5S)-4-fluoro-5-[3-[[2-(2,2,2-trifluoroethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate (PubChem CID 169142322) has the molecular formula C21H21F4N7O3 and a molecular weight of 495.44 g/mol. Its IUPAC name is [(3S,4R,5S)-4-fluoro-5-[3-[[2-(2,2,2-trifluoroethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate.
| Compound Name | [(3S,4R,5S)-4-fluoro-5-[3-[[2-(2,2,2-trifluoroethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
|---|---|
| PubChem CID | 169142322 |
| Molecular Formula | C21H21F4N7O3 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [(3S,4R,5S)-4-fluoro-5-[3-[[2-(2,2,2-trifluoroethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]-1H-pyrazol-5-yl]oxolan-3-yl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
| SMILES | O=C(NC12CC(C1)C2)O[C@H]1CO[C@@H](c2cc(Nc3nccc4nc(CC(F)(F)F)cn34)n[nH]2)[C@H]1F |
| InChI | InChI=1S/C21H21F4N7O3/c22-16-13(35-19(33)29-20-4-10(5-20)6-20)9-34-17(16)12-3-14(31-30-12)28-18-26-2-1-15-27-11(8-32(15)18)7-21(23,24)25/h1-3,8,10,13,16-17H,4-7,9H2,(H,29,33)(H2,26,28,30,31)/t10?,13-,16-,17-,20?/m0/s1 |
| InChIKey | GCENLKOCIZZMMY-WXDRVEHMSA-N |
| XLogP | 3.36 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |