C21H26F4N6O4 — CID 169142662
[(1S,2R,4R)-2-fluoro-4-[3-[[1-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrazole-5-carbonyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-methylcyclopropyl)carbamate (PubChem CID 169142662) has the molecular formula C21H26F4N6O4 and a molecular weight of 502.47 g/mol. Its IUPAC name is [(1S,2R,4R)-2-fluoro-4-[3-[[1-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrazole-5-carbonyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-methylcyclopropyl)carbamate.
| Compound Name | [(1S,2R,4R)-2-fluoro-4-[3-[[1-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrazole-5-carbonyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-methylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 169142662 |
| Molecular Formula | C21H26F4N6O4 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [(1S,2R,4R)-2-fluoro-4-[3-[[1-methyl-3-(2,2,2-trifluoroethoxymethyl)pyrazole-5-carbonyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-methylcyclopropyl)carbamate |
| SMILES | Cn1nc(COCC(F)(F)F)cc1C(=O)Nc1cc([C@H]2C[C@@H](F)[C@@H](OC(=O)NC3(C)CC3)C2)[nH]n1 |
| InChI | InChI=1S/C21H26F4N6O4/c1-20(3-4-20)27-19(33)35-16-6-11(5-13(16)22)14-8-17(29-28-14)26-18(32)15-7-12(30-31(15)2)9-34-10-21(23,24)25/h7-8,11,13,16H,3-6,9-10H2,1-2H3,(H,27,33)(H2,26,28,29,32)/t11-,13+,16-/m0/s1 |
| InChIKey | MGZKKCVCKLHVIA-GHJWDPDVSA-N |
| XLogP | 3.34 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |