C18H34FN3OSi — CID 169143584
1-tert-butyl-3-[(1S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-amine (PubChem CID 169143584) has the molecular formula C18H34FN3OSi and a molecular weight of 355.57 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-amine.
| Compound Name | 1-tert-butyl-3-[(1S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 169143584 |
| Molecular Formula | C18H34FN3OSi |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 1-tert-butyl-3-[(1S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-amine |
| SMILES | CC(C)(C)n1nc([C@@H]2C[C@H](F)[C@H](O[Si](C)(C)C(C)(C)C)C2)cc1N |
| InChI | InChI=1S/C18H34FN3OSi/c1-17(2,3)22-16(20)11-14(21-22)12-9-13(19)15(10-12)23-24(7,8)18(4,5)6/h11-13,15H,9-10,20H2,1-8H3/t12-,13+,15-/m1/s1 |
| InChIKey | WWOFCYVTLKHLKD-VNHYZAJKSA-N |
| XLogP | 4.83 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|