C15H13NO3 — CID 169143761
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,1-benzoxazole-5-carboxylic acid (PubChem CID 169143761) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,1-benzoxazole-5-carboxylic acid.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,1-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 169143761 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,1-benzoxazole-5-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C)c1onc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C15H13NO3/c1-3-5-10(6-4-2)14-12-9-11(15(17)18)7-8-13(12)16-19-14/h3-9H,1H2,2H3,(H,17,18)/b6-4-,10-5+ |
| InChIKey | WACPMXUCBWJOGN-KNVSICBPSA-N |
| XLogP | 3.67 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|