C23H25FN6O2 — CID 169143840
N,N'-diamino-3-[3-[1-(1-fluorocyclopropanecarbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide (PubChem CID 169143840) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is N,N'-diamino-3-[3-[1-(1-fluorocyclopropanecarbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide.
| Compound Name | N,N'-diamino-3-[3-[1-(1-fluorocyclopropanecarbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide |
|---|---|
| PubChem CID | 169143840 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N,N'-diamino-3-[3-[1-(1-fluorocyclopropanecarbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide |
| SMILES | N/N=C(\NN)c1ccc2noc(-c3cccc(C4CCN(C(=O)C5(F)CC5)CC4)c3)c2c1 |
| InChI | InChI=1S/C23H25FN6O2/c24-23(8-9-23)22(31)30-10-6-14(7-11-30)15-2-1-3-16(12-15)20-18-13-17(21(27-25)28-26)4-5-19(18)29-32-20/h1-5,12-14H,6-11,25-26H2,(H,27,28) |
| InChIKey | RYOOFHPPYKTUEH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|