C24H30N6O3 — CID 169143894
N,N'-diamino-3-[3-[1-(3-methyloxetane-3-carbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide;molecular hydrogen (PubChem CID 169143894) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is N,N'-diamino-3-[3-[1-(3-methyloxetane-3-carbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide;molecular hydrogen.
| Compound Name | N,N'-diamino-3-[3-[1-(3-methyloxetane-3-carbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide;molecular hydrogen |
|---|---|
| PubChem CID | 169143894 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N,N'-diamino-3-[3-[1-(3-methyloxetane-3-carbonyl)piperidin-4-yl]phenyl]-2,1-benzoxazole-5-carboximidamide;molecular hydrogen |
| SMILES | CC1(C(=O)N2CCC(c3cccc(-c4onc5ccc(/C(=N/N)NN)cc45)c3)CC2)COC1.[H][H] |
| InChI | InChI=1S/C24H28N6O3.H2/c1-24(13-32-14-24)23(31)30-9-7-15(8-10-30)16-3-2-4-17(11-16)21-19-12-18(22(27-25)28-26)5-6-20(19)29-33-21;/h2-6,11-12,15H,7-10,13-14,25-26H2,1H3,(H,27,28);1H |
| InChIKey | ZYLWYNUTHIWOIQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|