C18H32N2O3 — CID 169144108
tert-butyl 3-morpholin-4-yl-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 169144108) has the molecular formula C18H32N2O3 and a molecular weight of 324.46 g/mol. Its IUPAC name is tert-butyl 3-morpholin-4-yl-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-morpholin-4-yl-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 169144108 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl 3-morpholin-4-yl-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(N3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C18H32N2O3/c1-17(2,3)23-16(21)20-8-6-18(7-9-20)5-4-15(14-18)19-10-12-22-13-11-19/h15H,4-14H2,1-3H3 |
| InChIKey | LHZSIJJEVUYJLJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |