About N-benzylpropan-2-amine;propan-2-yloxybenzene
N-benzylpropan-2-amine;propan-2-yloxybenzene (PubChem CID 169144448) has the molecular formula C19H27NO
and a molecular weight of 285.43 g/mol. Its IUPAC name is N-benzylpropan-2-amine;propan-2-yloxybenzene.
Molecular Properties
| Compound Name | N-benzylpropan-2-amine;propan-2-yloxybenzene |
| PubChem CID | 169144448 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-benzylpropan-2-amine;propan-2-yloxybenzene |
| SMILES | CC(C)NCc1ccccc1.CC(C)Oc1ccccc1 |
| InChI | InChI=1S/C10H15N.C9H12O/c1-9(2)11-8-10-6-4-3-5-7-10;1-8(2)10-9-6-4-3-5-7-9/h3-7,9,11H,8H2,1-2H3;3-8H,1-2H3 |
| InChIKey | ULPSWRBAHWWLTR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzylpropan-2-amine;propan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylpropan-2-amine;propan-2-yloxybenzene?
The IUPAC name of N-benzylpropan-2-amine;propan-2-yloxybenzene (CID 169144448) is N-benzylpropan-2-amine;propan-2-yloxybenzene.
What is the SMILES notation for N-benzylpropan-2-amine;propan-2-yloxybenzene?
The canonical SMILES for N-benzylpropan-2-amine;propan-2-yloxybenzene is CC(C)NCc1ccccc1.CC(C)Oc1ccccc1.
What is the InChIKey of N-benzylpropan-2-amine;propan-2-yloxybenzene?
The InChIKey is ULPSWRBAHWWLTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C9H12O/c1-9(2)11-8-10-6-4-3-5-7-10;1-8(2)10-9-6-4-3-5-7-9/h3-7,9,11H,8H2,1-2H3;3-8H,1-2H3.
What are the key properties of N-benzylpropan-2-amine;propan-2-yloxybenzene?
N-benzylpropan-2-amine;propan-2-yloxybenzene has a molecular weight of 285.43 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylpropan-2-amine;propan-2-yloxybenzene is sourced from PubChem (CID 169144448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).