About ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate
ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate (PubChem CID 169144514) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate |
| PubChem CID | 169144514 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate |
| SMILES | CC.COC(=O)c1c[nH]c(-c2ncccn2)c1 |
| InChI | InChI=1S/C10H9N3O2.C2H6/c1-15-10(14)7-5-8(13-6-7)9-11-3-2-4-12-9;1-2/h2-6,13H,1H3;1-2H3 |
| InChIKey | ABVBAFPPHUENFK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate?
The IUPAC name of ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate (CID 169144514) is ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate?
The canonical SMILES for ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate is CC.COC(=O)c1c[nH]c(-c2ncccn2)c1.
What is the InChIKey of ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate?
The InChIKey is ABVBAFPPHUENFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2.C2H6/c1-15-10(14)7-5-8(13-6-7)9-11-3-2-4-12-9;1-2/h2-6,13H,1H3;1-2H3.
What are the key properties of ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate?
ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 5-pyrimidin-2-yl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 169144514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).