C29H34ClFN4O2 — CID 169145472
7-chloro-2'-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4'-(2,3,6,7-tetrahydroazepin-1-yl)spiro[1,2-dihydroindene-3,7'-5,8-dihydropyrano[4,3-d]pyrimidine] (PubChem CID 169145472) has the molecular formula C29H34ClFN4O2 and a molecular weight of 525.07 g/mol. Its IUPAC name is 7-chloro-2'-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4'-(2,3,6,7-tetrahydroazepin-1-yl)spiro[1,2-dihydroindene-3,7'-5,8-dihydropyrano[4,3-d]pyrimidine].
| Compound Name | 7-chloro-2'-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4'-(2,3,6,7-tetrahydroazepin-1-yl)spiro[1,2-dihydroindene-3,7'-5,8-dihydropyrano[4,3-d]pyrimidine] |
|---|---|
| PubChem CID | 169145472 |
| Molecular Formula | C29H34ClFN4O2 |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 7-chloro-2'-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4'-(2,3,6,7-tetrahydroazepin-1-yl)spiro[1,2-dihydroindene-3,7'-5,8-dihydropyrano[4,3-d]pyrimidine] |
| SMILES | F[C@H]1CN2CCC[C@@]2(COc2nc3c(c(N4CCC=CCC4)n2)COC2(CCc4c(Cl)cccc42)C3)C1 |
| InChI | InChI=1S/C29H34ClFN4O2/c30-24-8-5-7-23-21(24)9-11-29(23)16-25-22(18-37-29)26(34-12-3-1-2-4-13-34)33-27(32-25)36-19-28-10-6-14-35(28)17-20(31)15-28/h1-2,5,7-8,20H,3-4,6,9-19H2/t20-,28+,29?/m1/s1 |
| InChIKey | FYJPKBYIHQJNRD-SQZORMKFSA-N |
| XLogP | 5.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|