C11H23InN3O2 — CID 169145668
CID 169145668 (PubChem CID 169145668) has the molecular formula C11H23InN3O2 and a molecular weight of 344.14 g/mol.
| Compound Name | CID 169145668 |
|---|---|
| PubChem CID | 169145668 |
| Molecular Formula | C11H23InN3O2 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | — |
| SMILES | CCC(C)N1CCCC2(C1)NC(=O)NC2=O.[H][H].[H][H].[In] |
| InChI | InChI=1S/C11H19N3O2.In.2H2/c1-3-8(2)14-6-4-5-11(7-14)9(15)12-10(16)13-11;;;/h8H,3-7H2,1-2H3,(H2,12,13,15,16);;2*1H |
| InChIKey | UZAZSNYFZBSCNH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|