C26H31Cl3N7O+ — CID 169145720
(3E)-3-chloro-3-[4-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-1,4-diazepan-1-ium-2-ylidene]-2-imino-N,N-dimethylpropanamide (PubChem CID 169145720) has the molecular formula C26H31Cl3N7O+ and a molecular weight of 563.94 g/mol. Its IUPAC name is (3E)-3-chloro-3-[4-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-1,4-diazepan-1-ium-2-ylidene]-2-imino-N,N-dimethylpropanamide.
| Compound Name | (3E)-3-chloro-3-[4-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-1,4-diazepan-1-ium-2-ylidene]-2-imino-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 169145720 |
| Molecular Formula | C26H31Cl3N7O+ |
| Molecular Weight | 563.94 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | (3E)-3-chloro-3-[4-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-1,4-diazepan-1-ium-2-ylidene]-2-imino-N,N-dimethylpropanamide |
| SMILES | [H]/N=C(C(=O)N(C)C)/C(Cl)=C1/CN(c2nc(Cl)nc3c2CN(C)[C@@]2(CCc4c(Cl)cccc42)C3)CCC[NH2+]1 |
| InChI | InChI=1S/C26H30Cl3N7O/c1-34(2)24(37)22(30)21(28)20-14-36(11-5-10-31-20)23-16-13-35(3)26(12-19(16)32-25(29)33-23)9-8-15-17(26)6-4-7-18(15)27/h4,6-7,30-31H,5,8-14H2,1-3H3/p+1/b21-20+,30-22-/t26-/m0/s1 |
| InChIKey | ISHYUGFQWDAAEG-SWBIUCMNSA-O |
| XLogP | 2.94 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|