C26H30Cl3N7O — CID 169145721
2-amino-3-chloro-3-[1-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide (PubChem CID 169145721) has the molecular formula C26H30Cl3N7O and a molecular weight of 562.93 g/mol. Its IUPAC name is 2-amino-3-chloro-3-[1-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | 2-amino-3-chloro-3-[1-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 169145721 |
| Molecular Formula | C26H30Cl3N7O |
| Molecular Weight | 562.93 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 2-amino-3-chloro-3-[1-[(3S)-2',7-dichloro-6'-methylspiro[1,2-dihydroindene-3,7'-5,8-dihydropyrido[4,3-d]pyrimidine]-4'-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C(N)=C(Cl)C1=NCCCN(c2nc(Cl)nc3c2CN(C)[C@@]2(CCc4c(Cl)cccc42)C3)C1 |
| InChI | InChI=1S/C26H30Cl3N7O/c1-34(2)24(37)22(30)21(28)20-14-36(11-5-10-31-20)23-16-13-35(3)26(12-19(16)32-25(29)33-23)9-8-15-17(26)6-4-7-18(15)27/h4,6-7H,5,8-14,30H2,1-3H3/t26-/m0/s1 |
| InChIKey | FBACDJSOPRKCHS-SANMLTNESA-N |
| XLogP | 3.76 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|