C28H39ClN6O — CID 169145757
4-(3-chloro-2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)-7-[(2Z,4E)-5-ethenylocta-2,4-dien-4-yl]-6-ethyl-2-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 169145757) has the molecular formula C28H39ClN6O and a molecular weight of 511.11 g/mol. Its IUPAC name is 4-(3-chloro-2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)-7-[(2Z,4E)-5-ethenylocta-2,4-dien-4-yl]-6-ethyl-2-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-chloro-2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)-7-[(2Z,4E)-5-ethenylocta-2,4-dien-4-yl]-6-ethyl-2-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 169145757 |
| Molecular Formula | C28H39ClN6O |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 4-(3-chloro-2-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl)-7-[(2Z,4E)-5-ethenylocta-2,4-dien-4-yl]-6-ethyl-2-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | C=C/C(CCC)=C(\C=C/C)C1Cc2nc(OC)nc(N3CCCn4nc(C)c(Cl)c4C3)c2CN1CC |
| InChI | InChI=1S/C28H39ClN6O/c1-7-12-20(9-3)21(13-8-2)24-16-23-22(17-33(24)10-4)27(31-28(30-23)36-6)34-14-11-15-35-25(18-34)26(29)19(5)32-35/h8-9,13,24H,3,7,10-12,14-18H2,1-2,4-6H3/b13-8-,21-20- |
| InChIKey | TZBMSQFDPPFSEP-MBCMKVIVSA-N |
| XLogP | 5.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|