About 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol
7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol (PubChem CID 169146022) has the molecular formula C13H17ClO
and a molecular weight of 224.73 g/mol. Its IUPAC name is 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol.
Molecular Properties
| Compound Name | 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol |
| PubChem CID | 169146022 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol |
| SMILES | CC(C)C1(C)CCc2c(Cl)ccc(O)c21 |
| InChI | InChI=1S/C13H17ClO/c1-8(2)13(3)7-6-9-10(14)4-5-11(15)12(9)13/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | UATMROKQFQSTBY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol?
The IUPAC name of 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol (CID 169146022) is 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol.
What is the SMILES notation for 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol?
The canonical SMILES for 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol is CC(C)C1(C)CCc2c(Cl)ccc(O)c21.
What is the InChIKey of 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol?
The InChIKey is UATMROKQFQSTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO/c1-8(2)13(3)7-6-9-10(14)4-5-11(15)12(9)13/h4-5,8,15H,6-7H2,1-3H3.
What are the key properties of 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol?
7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol has a molecular weight of 224.73 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-methyl-3-propan-2-yl-1,2-dihydroinden-4-ol is sourced from PubChem (CID 169146022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).