C32H38N3O7PS — CID 169146886
6-[1-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl methyl hydrogen phosphite (PubChem CID 169146886) has the molecular formula C32H38N3O7PS and a molecular weight of 639.71 g/mol. Its IUPAC name is 6-[1-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl methyl hydrogen phosphite.
| Compound Name | 6-[1-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl methyl hydrogen phosphite |
|---|---|
| PubChem CID | 169146886 |
| Molecular Formula | C32H38N3O7PS |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | 6-[1-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl methyl hydrogen phosphite |
| SMILES | COP(O)OCCCCCCSC1CC(=O)N(CCC(=O)NCCC(=O)N2Cc3ccccc3C#Cc3ccccc32)C1=O |
| InChI | InChI=1S/C32H38N3O7PS/c1-41-43(40)42-20-8-2-3-9-21-44-28-22-31(38)34(32(28)39)19-17-29(36)33-18-16-30(37)35-23-26-12-5-4-10-24(26)14-15-25-11-6-7-13-27(25)35/h4-7,10-13,28,40H,2-3,8-9,16-23H2,1H3,(H,33,36) |
| InChIKey | QFADEMWDMBPGBI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|