C23H20N6O3S — CID 169147353
8-[[1-(cyanoamino)sulfanylcyclopropyl]methoxy]-N-[(4-cyanophenyl)methyl]-1-methyl-2-oxo-1,7-naphthyridine-3-carboxamide (PubChem CID 169147353) has the molecular formula C23H20N6O3S and a molecular weight of 460.52 g/mol. Its IUPAC name is 8-[[1-(cyanoamino)sulfanylcyclopropyl]methoxy]-N-[(4-cyanophenyl)methyl]-1-methyl-2-oxo-1,7-naphthyridine-3-carboxamide.
| Compound Name | 8-[[1-(cyanoamino)sulfanylcyclopropyl]methoxy]-N-[(4-cyanophenyl)methyl]-1-methyl-2-oxo-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169147353 |
| Molecular Formula | C23H20N6O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 8-[[1-(cyanoamino)sulfanylcyclopropyl]methoxy]-N-[(4-cyanophenyl)methyl]-1-methyl-2-oxo-1,7-naphthyridine-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)NCc2ccc(C#N)cc2)cc2ccnc(OCC3(SNC#N)CC3)c21 |
| InChI | InChI=1S/C23H20N6O3S/c1-29-19-17(6-9-26-21(19)32-13-23(7-8-23)33-28-14-25)10-18(22(29)31)20(30)27-12-16-4-2-15(11-24)3-5-16/h2-6,9-10,28H,7-8,12-13H2,1H3,(H,27,30) |
| InChIKey | JLDBQMSHBQERRO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|