About 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol
4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol (PubChem CID 169149047) has the molecular formula C16H26FN3S
and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol.
Molecular Properties
| Compound Name | 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol |
| PubChem CID | 169149047 |
| Molecular Formula | C16H26FN3S |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol |
| SMILES | CS.Nc1ccc(N2CCC(N3CCC(F)C3)CC2)cc1 |
| InChI | InChI=1S/C15H22FN3.CH4S/c16-12-5-8-19(11-12)15-6-9-18(10-7-15)14-3-1-13(17)2-4-14;1-2/h1-4,12,15H,5-11,17H2;2H,1H3 |
| InChIKey | URAUMCAABFGQEG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol?
The IUPAC name of 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol (CID 169149047) is 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol.
What is the SMILES notation for 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol?
The canonical SMILES for 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol is CS.Nc1ccc(N2CCC(N3CCC(F)C3)CC2)cc1.
What is the InChIKey of 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol?
The InChIKey is URAUMCAABFGQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FN3.CH4S/c16-12-5-8-19(11-12)15-6-9-18(10-7-15)14-3-1-13(17)2-4-14;1-2/h1-4,12,15H,5-11,17H2;2H,1H3.
What are the key properties of 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol?
4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol has a molecular weight of 311.47 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]aniline;methanethiol is sourced from PubChem (CID 169149047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).