About 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one
2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one (PubChem CID 169149090) has the molecular formula C16H23F2N3O
and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one |
| PubChem CID | 169149090 |
| Molecular Formula | C16H23F2N3O |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cnc(C2CCN(C3CCC(F)(F)CC3)C2)[nH]c1=O |
| InChI | InChI=1S/C16H23F2N3O/c1-2-11-9-19-14(20-15(11)22)12-5-8-21(10-12)13-3-6-16(17,18)7-4-13/h9,12-13H,2-8,10H2,1H3,(H,19,20,22) |
| InChIKey | VLANBPPPUNVANE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one?
The IUPAC name of 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one (CID 169149090) is 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one is CCc1cnc(C2CCN(C3CCC(F)(F)CC3)C2)[nH]c1=O.
What is the InChIKey of 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one?
The InChIKey is VLANBPPPUNVANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2N3O/c1-2-11-9-19-14(20-15(11)22)12-5-8-21(10-12)13-3-6-16(17,18)7-4-13/h9,12-13H,2-8,10H2,1H3,(H,19,20,22).
What are the key properties of 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one?
2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one has a molecular weight of 311.38 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,4-difluorocyclohexyl)pyrrolidin-3-yl]-5-ethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 169149090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).