C8H13N3S — CID 169149276
6-amino-2,3-dimethyl-1,2-dihydropyridine-5-carbothioamide (PubChem CID 169149276) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 6-amino-2,3-dimethyl-1,2-dihydropyridine-5-carbothioamide.
| Compound Name | 6-amino-2,3-dimethyl-1,2-dihydropyridine-5-carbothioamide |
|---|---|
| PubChem CID | 169149276 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 6-amino-2,3-dimethyl-1,2-dihydropyridine-5-carbothioamide |
| SMILES | CC1=CC(C(N)=S)=C(N)NC1C |
| InChI | InChI=1S/C8H13N3S/c1-4-3-6(8(10)12)7(9)11-5(4)2/h3,5,11H,9H2,1-2H3,(H2,10,12) |
| InChIKey | NHPCOORERLWXCB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|