About 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one
4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 169150069) has the molecular formula C13H14ClF2N3OS
and a molecular weight of 333.79 g/mol. Its IUPAC name is 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| PubChem CID | 169150069 |
| Molecular Formula | C13H14ClF2N3OS |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CSc1nc(Cl)c2c(n1)CN([C@H]1CCCCC1(F)F)C2=O |
| InChI | InChI=1S/C13H14ClF2N3OS/c1-21-12-17-7-6-19(11(20)9(7)10(14)18-12)8-4-2-3-5-13(8,15)16/h8H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | OYRKTTCLTQVAKZ-QMMMGPOBSA-N |
| XLogP | 3.39 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The IUPAC name of 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (CID 169150069) is 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is CSc1nc(Cl)c2c(n1)CN([C@H]1CCCCC1(F)F)C2=O.
What is the InChIKey of 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The InChIKey is OYRKTTCLTQVAKZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H14ClF2N3OS/c1-21-12-17-7-6-19(11(20)9(7)10(14)18-12)8-4-2-3-5-13(8,15)16/h8H,2-6H2,1H3/t8-/m0/s1.
What are the key properties of 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one has a molecular weight of 333.79 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(1S)-2,2-difluorocyclohexyl]-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 169150069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).