C20H30ClNO5 — CID 169150406
[(3R,5S,6R)-5-methoxy-4-[(2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl] N-(2-chloroacetyl)carbamate (PubChem CID 169150406) has the molecular formula C20H30ClNO5 and a molecular weight of 399.92 g/mol. Its IUPAC name is [(3R,5S,6R)-5-methoxy-4-[(2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl] N-(2-chloroacetyl)carbamate.
| Compound Name | [(3R,5S,6R)-5-methoxy-4-[(2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl] N-(2-chloroacetyl)carbamate |
|---|---|
| PubChem CID | 169150406 |
| Molecular Formula | C20H30ClNO5 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(3R,5S,6R)-5-methoxy-4-[(2S)-1-methyl-2-(3-methylbut-2-enyl)cyclopropyl]-1-oxaspiro[2.5]octan-6-yl] N-(2-chloroacetyl)carbamate |
| SMILES | CO[C@H]1C(C2(C)C[C@@H]2CC=C(C)C)[C@]2(CC[C@H]1OC(=O)NC(=O)CCl)CO2 |
| InChI | InChI=1S/C20H30ClNO5/c1-12(2)5-6-13-9-19(13,3)17-16(25-4)14(7-8-20(17)11-26-20)27-18(24)22-15(23)10-21/h5,13-14,16-17H,6-11H2,1-4H3,(H,22,23,24)/t13-,14+,16+,17?,19?,20-/m0/s1 |
| InChIKey | GBGJLLWCBJFNRD-ZCZIWCAFSA-N |
| XLogP | 3.42 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|