C11H19BO4 — CID 169150951
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobutane-1-carboxylic acid (PubChem CID 169150951) has the molecular formula C11H19BO4 and a molecular weight of 226.08 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 169150951 |
| Molecular Formula | C11H19BO4 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclobutane-1-carboxylic acid |
| SMILES | CC1(C)OB(C2CC(C(=O)O)C2)OC1(C)C |
| InChI | InChI=1S/C11H19BO4/c1-10(2)11(3,4)16-12(15-10)8-5-7(6-8)9(13)14/h7-8H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | IEPJLHCNFNQWDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|