About 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate
5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate (PubChem CID 169151252) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate.
Molecular Properties
| Compound Name | 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate |
| PubChem CID | 169151252 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate |
| SMILES | C=C(C=O)NC(=O)c1ccc(-c2ccc(N)cc2)s1.C=C(NC)C(=O)OC |
| InChI | InChI=1S/C14H12N2O2S.C5H9NO2/c1-9(8-17)16-14(18)13-7-6-12(19-13)10-2-4-11(15)5-3-10;1-4(6-2)5(7)8-3/h2-8H,1,15H2,(H,16,18);6H,1H2,2-3H3 |
| InChIKey | KXJDWNYDDCLPMP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate?
The IUPAC name of 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate (CID 169151252) is 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate.
What is the SMILES notation for 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate?
The canonical SMILES for 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate is C=C(C=O)NC(=O)c1ccc(-c2ccc(N)cc2)s1.C=C(NC)C(=O)OC.
What is the InChIKey of 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate?
The InChIKey is KXJDWNYDDCLPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S.C5H9NO2/c1-9(8-17)16-14(18)13-7-6-12(19-13)10-2-4-11(15)5-3-10;1-4(6-2)5(7)8-3/h2-8H,1,15H2,(H,16,18);6H,1H2,2-3H3.
What are the key properties of 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate?
5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate has a molecular weight of 387.46 g/mol, XLogP of 2.33, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminophenyl)-N-(3-oxoprop-1-en-2-yl)thiophene-2-carboxamide;methyl 2-(methylamino)prop-2-enoate is sourced from PubChem (CID 169151252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).