C17H17ClN4O4S — CID 169151402
methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate;hydrochloride (PubChem CID 169151402) has the molecular formula C17H17ClN4O4S and a molecular weight of 408.87 g/mol. Its IUPAC name is methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate;hydrochloride.
| Compound Name | methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 169151402 |
| Molecular Formula | C17H17ClN4O4S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | methyl 2-[2-[[2-(4-aminophenyl)-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate;hydrochloride |
| SMILES | C=C(NC(=O)c1csc(-c2ccc(N)cc2)n1)C(=O)NC(=C)C(=O)OC.Cl |
| InChI | InChI=1S/C17H16N4O4S.ClH/c1-9(14(22)20-10(2)17(24)25-3)19-15(23)13-8-26-16(21-13)11-4-6-12(18)7-5-11;/h4-8H,1-2,18H2,3H3,(H,19,23)(H,20,22);1H |
| InChIKey | XXCJKAVIRMMRHP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|