About 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone
1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone (PubChem CID 169152803) has the molecular formula C9H7F2NO4
and a molecular weight of 231.15 g/mol. Its IUPAC name is 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone |
| PubChem CID | 169152803 |
| Molecular Formula | C9H7F2NO4 |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone |
| SMILES | CC(=O)c1cc2c(c(O)c1N)OC(F)(F)O2 |
| InChI | InChI=1S/C9H7F2NO4/c1-3(13)4-2-5-8(7(14)6(4)12)16-9(10,11)15-5/h2,14H,12H2,1H3 |
| InChIKey | SHCCBPGHTMPTEE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone?
The IUPAC name of 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone (CID 169152803) is 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone.
What is the SMILES notation for 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone?
The canonical SMILES for 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone is CC(=O)c1cc2c(c(O)c1N)OC(F)(F)O2.
What is the InChIKey of 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone?
The InChIKey is SHCCBPGHTMPTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2NO4/c1-3(13)4-2-5-8(7(14)6(4)12)16-9(10,11)15-5/h2,14H,12H2,1H3.
What are the key properties of 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone?
1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone has a molecular weight of 231.15 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2,2-difluoro-7-hydroxy-1,3-benzodioxol-5-yl)ethanone is sourced from PubChem (CID 169152803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).