About 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one
8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one (PubChem CID 169154629) has the molecular formula C18H21F2N3O2
and a molecular weight of 349.38 g/mol. Its IUPAC name is 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one |
| PubChem CID | 169154629 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one |
| SMILES | CCn1c(N2CCC(F)(F)CC2)nc2c(C(C)=O)cc(C)cc2c1=O |
| InChI | InChI=1S/C18H21F2N3O2/c1-4-23-16(25)14-10-11(2)9-13(12(3)24)15(14)21-17(23)22-7-5-18(19,20)6-8-22/h9-10H,4-8H2,1-3H3 |
| InChIKey | CWQHVSUCDDTFPN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one?
The IUPAC name of 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one (CID 169154629) is 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one.
What is the SMILES notation for 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one?
The canonical SMILES for 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one is CCn1c(N2CCC(F)(F)CC2)nc2c(C(C)=O)cc(C)cc2c1=O.
What is the InChIKey of 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one?
The InChIKey is CWQHVSUCDDTFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N3O2/c1-4-23-16(25)14-10-11(2)9-13(12(3)24)15(14)21-17(23)22-7-5-18(19,20)6-8-22/h9-10H,4-8H2,1-3H3.
What are the key properties of 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one?
8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one has a molecular weight of 349.38 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-acetyl-2-(4,4-difluoropiperidin-1-yl)-3-ethyl-6-methylquinazolin-4-one is sourced from PubChem (CID 169154629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).