About 8-acetyl-2,3,6-trimethylquinazolin-4-one
8-acetyl-2,3,6-trimethylquinazolin-4-one (PubChem CID 169155169) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 8-acetyl-2,3,6-trimethylquinazolin-4-one.
Molecular Properties
| Compound Name | 8-acetyl-2,3,6-trimethylquinazolin-4-one |
| PubChem CID | 169155169 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 8-acetyl-2,3,6-trimethylquinazolin-4-one |
| SMILES | CC(=O)c1cc(C)cc2c(=O)n(C)c(C)nc12 |
| InChI | InChI=1S/C13H14N2O2/c1-7-5-10(8(2)16)12-11(6-7)13(17)15(4)9(3)14-12/h5-6H,1-4H3 |
| InChIKey | WDZLORWRKGIHJF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-acetyl-2,3,6-trimethylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-acetyl-2,3,6-trimethylquinazolin-4-one?
The IUPAC name of 8-acetyl-2,3,6-trimethylquinazolin-4-one (CID 169155169) is 8-acetyl-2,3,6-trimethylquinazolin-4-one.
What is the SMILES notation for 8-acetyl-2,3,6-trimethylquinazolin-4-one?
The canonical SMILES for 8-acetyl-2,3,6-trimethylquinazolin-4-one is CC(=O)c1cc(C)cc2c(=O)n(C)c(C)nc12.
What is the InChIKey of 8-acetyl-2,3,6-trimethylquinazolin-4-one?
The InChIKey is WDZLORWRKGIHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-7-5-10(8(2)16)12-11(6-7)13(17)15(4)9(3)14-12/h5-6H,1-4H3.
What are the key properties of 8-acetyl-2,3,6-trimethylquinazolin-4-one?
8-acetyl-2,3,6-trimethylquinazolin-4-one has a molecular weight of 230.27 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-acetyl-2,3,6-trimethylquinazolin-4-one is sourced from PubChem (CID 169155169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).