About 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide
5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide (PubChem CID 169155671) has the molecular formula C13H22N6O2
and a molecular weight of 294.36 g/mol. Its IUPAC name is 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide |
| PubChem CID | 169155671 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide |
| SMILES | CNC(=O)c1c(C)cnn1C.COCc1c(N)cnn1C |
| InChI | InChI=1S/C7H11N3O.C6H11N3O/c1-5-4-9-10(3)6(5)7(11)8-2;1-9-6(4-10-2)5(7)3-8-9/h4H,1-3H3,(H,8,11);3H,4,7H2,1-2H3 |
| InChIKey | MRDUBDTWQLHEAY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide?
The IUPAC name of 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide (CID 169155671) is 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide.
What is the SMILES notation for 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide?
The canonical SMILES for 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide is CNC(=O)c1c(C)cnn1C.COCc1c(N)cnn1C.
What is the InChIKey of 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide?
The InChIKey is MRDUBDTWQLHEAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.C6H11N3O/c1-5-4-9-10(3)6(5)7(11)8-2;1-9-6(4-10-2)5(7)3-8-9/h4H,1-3H3,(H,8,11);3H,4,7H2,1-2H3.
What are the key properties of 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide?
5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide has a molecular weight of 294.36 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-1-methylpyrazol-4-amine;N,1,4-trimethylpyrazole-5-carboxamide is sourced from PubChem (CID 169155671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).