C7H9F3N2O2 — CID 169156001
1-(1,4-dimethylpyrazol-5-yl)-2,2,2-trifluoroethane-1,1-diol (PubChem CID 169156001) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. Its IUPAC name is 1-(1,4-dimethylpyrazol-5-yl)-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-(1,4-dimethylpyrazol-5-yl)-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 169156001 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(1,4-dimethylpyrazol-5-yl)-2,2,2-trifluoroethane-1,1-diol |
| SMILES | Cc1cnn(C)c1C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O2/c1-4-3-11-12(2)5(4)6(13,14)7(8,9)10/h3,13-14H,1-2H3 |
| InChIKey | BFBNEIQCUDDRFR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|