About N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide
N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide (PubChem CID 169156131) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide |
| PubChem CID | 169156131 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide |
| SMILES | Cc1cnn(C)c1C(=O)N(C)C1CC1 |
| InChI | InChI=1S/C10H15N3O/c1-7-6-11-13(3)9(7)10(14)12(2)8-4-5-8/h6,8H,4-5H2,1-3H3 |
| InChIKey | PUGGLMVKGAGZBF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide?
The IUPAC name of N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide (CID 169156131) is N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide.
What is the SMILES notation for N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide?
The canonical SMILES for N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide is Cc1cnn(C)c1C(=O)N(C)C1CC1.
What is the InChIKey of N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide?
The InChIKey is PUGGLMVKGAGZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7-6-11-13(3)9(7)10(14)12(2)8-4-5-8/h6,8H,4-5H2,1-3H3.
What are the key properties of N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide?
N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide has a molecular weight of 193.25 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N,1,4-trimethylpyrazole-5-carboxamide is sourced from PubChem (CID 169156131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).