About N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine
N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine (PubChem CID 169156330) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine |
| PubChem CID | 169156330 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C/C(=N\O)C[C@H](C)O1 |
| InChI | InChI=1S/C7H13NO2/c1-5-3-7(8-9)4-6(2)10-5/h5-6,9H,3-4H2,1-2H3/b8-7-/t5-,6+/m0/s1 |
| InChIKey | FHNSYVGRUCWKCU-YALLPQADSA-N |
| XLogP | 1.40 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine?
The IUPAC name of N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine (CID 169156330) is N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine.
What is the SMILES notation for N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine?
The canonical SMILES for N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine is C[C@@H]1C/C(=N\O)C[C@H](C)O1.
What is the InChIKey of N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine?
The InChIKey is FHNSYVGRUCWKCU-YALLPQADSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-3-7(8-9)4-6(2)10-5/h5-6,9H,3-4H2,1-2H3/b8-7-/t5-,6+/m0/s1.
What are the key properties of N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine?
N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine has a molecular weight of 143.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,6R)-2,6-dimethyloxan-4-ylidene]hydroxylamine is sourced from PubChem (CID 169156330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).