C35H39NO — CID 169156726
16,19,19-trimethyl-7-(2,4,6-trimethylphenyl)-11-azahexacyclo[14.6.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5(10),6,8,12-hexaen-15-one (PubChem CID 169156726) has the molecular formula C35H39NO and a molecular weight of 489.70 g/mol. Its IUPAC name is 16,19,19-trimethyl-7-(2,4,6-trimethylphenyl)-11-azahexacyclo[14.6.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5(10),6,8,12-hexaen-15-one.
| Compound Name | 16,19,19-trimethyl-7-(2,4,6-trimethylphenyl)-11-azahexacyclo[14.6.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5(10),6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 169156726 |
| Molecular Formula | C35H39NO |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 16,19,19-trimethyl-7-(2,4,6-trimethylphenyl)-11-azahexacyclo[14.6.2.01,18.02,14.04,12.05,10]tetracosa-2(14),3,5(10),6,8,12-hexaen-15-one |
| SMILES | Cc1cc(C)c(-c2ccc3[nH]c4cc5c(cc4c3c2)C23CCCC(C)(C)C2CC(C)(CC3)C5=O)c(C)c1 |
| InChI | InChI=1S/C35H39NO/c1-20-14-21(2)31(22(3)15-20)23-8-9-28-24(16-23)25-17-27-26(18-29(25)36-28)32(37)34(6)12-13-35(27)11-7-10-33(4,5)30(35)19-34/h8-9,14-18,30,36H,7,10-13,19H2,1-6H3 |
| InChIKey | MXFMZXUZUZBDHN-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |