C41H49NO — CID 169156754
1,16-dimethyl-7-(1,1,3,3,5,5,7,7-octamethyl-2,6-dihydro-s-indacen-4-yl)-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one (PubChem CID 169156754) has the molecular formula C41H49NO and a molecular weight of 571.85 g/mol. Its IUPAC name is 1,16-dimethyl-7-(1,1,3,3,5,5,7,7-octamethyl-2,6-dihydro-s-indacen-4-yl)-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one.
| Compound Name | 1,16-dimethyl-7-(1,1,3,3,5,5,7,7-octamethyl-2,6-dihydro-s-indacen-4-yl)-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 169156754 |
| Molecular Formula | C41H49NO |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | 1,16-dimethyl-7-(1,1,3,3,5,5,7,7-octamethyl-2,6-dihydro-s-indacen-4-yl)-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
| SMILES | CC12CCC(C)(CC1)c1cc3c(cc1C2=O)[nH]c1ccc(-c2c4c(cc5c2C(C)(C)CC5(C)C)C(C)(C)CC4(C)C)cc13 |
| InChI | InChI=1S/C41H49NO/c1-36(2)21-38(5,6)33-28(36)20-29-34(39(7,8)22-37(29,3)4)32(33)23-11-12-30-24(17-23)25-18-27-26(19-31(25)42-30)35(43)41(10)15-13-40(27,9)14-16-41/h11-12,17-20,42H,13-16,21-22H2,1-10H3 |
| InChIKey | GSKZDVAVBUVBPM-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |