About 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid
6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 169156914) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid |
| PubChem CID | 169156914 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c[nH]c(=S)cc2[nH]1 |
| InChI | InChI=1S/C8H6N2O2S/c11-8(12)6-1-4-3-9-7(13)2-5(4)10-6/h1-3,10H,(H,9,13)(H,11,12) |
| InChIKey | BBNFLEFENBILNK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid?
The IUPAC name of 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid (CID 169156914) is 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid?
The canonical SMILES for 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid is O=C(O)c1cc2c[nH]c(=S)cc2[nH]1.
What is the InChIKey of 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid?
The InChIKey is BBNFLEFENBILNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-8(12)6-1-4-3-9-7(13)2-5(4)10-6/h1-3,10H,(H,9,13)(H,11,12).
What are the key properties of 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid?
6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid has a molecular weight of 194.22 g/mol, XLogP of 1.92, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanylidene-1,5-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 169156914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).