About 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde
3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde (PubChem CID 169158407) has the molecular formula C9H9FN2O
and a molecular weight of 180.18 g/mol. Its IUPAC name is 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde |
| PubChem CID | 169158407 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde |
| SMILES | O=CN1CCc2ncc(F)cc2C1 |
| InChI | InChI=1S/C9H9FN2O/c10-8-3-7-5-12(6-13)2-1-9(7)11-4-8/h3-4,6H,1-2,5H2 |
| InChIKey | OVLGDFCXXBHOBK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde?
The IUPAC name of 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde (CID 169158407) is 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde.
What is the SMILES notation for 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde?
The canonical SMILES for 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde is O=CN1CCc2ncc(F)cc2C1.
What is the InChIKey of 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde?
The InChIKey is OVLGDFCXXBHOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O/c10-8-3-7-5-12(6-13)2-1-9(7)11-4-8/h3-4,6H,1-2,5H2.
What are the key properties of 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde?
3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde has a molecular weight of 180.18 g/mol, XLogP of 0.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-7,8-dihydro-5H-1,6-naphthyridine-6-carbaldehyde is sourced from PubChem (CID 169158407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).