C24H31F3N4O4 — CID 169158714
2-[[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopentyl]methoxy]acetonitrile (PubChem CID 169158714) has the molecular formula C24H31F3N4O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is 2-[[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopentyl]methoxy]acetonitrile.
| Compound Name | 2-[[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopentyl]methoxy]acetonitrile |
|---|---|
| PubChem CID | 169158714 |
| Molecular Formula | C24H31F3N4O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-[[(1S,3R)-3-[[(3S,4S)-3-methoxyoxan-4-yl]amino]-1-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]cyclopentyl]methoxy]acetonitrile |
| SMILES | CO[C@@H]1COCC[C@@H]1N[C@@H]1CC[C@](COCC#N)(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C24H31F3N4O4/c1-33-21-14-34-8-4-20(21)30-18-2-5-23(11-18,15-35-9-6-28)22(32)31-7-3-19-16(13-31)10-17(12-29-19)24(25,26)27/h10,12,18,20-21,30H,2-5,7-9,11,13-15H2,1H3/t18-,20+,21-,23+/m1/s1 |
| InChIKey | LEOVSWNMEQQONL-RJSMDTJLSA-N |
| XLogP | 2.46 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|