C18H29NO5 — CID 169159364
2-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]-2-pyridinyl]propan-1-one (PubChem CID 169159364) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]-2-pyridinyl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]-2-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 169159364 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]-2-pyridinyl]propan-1-one |
| SMILES | CC(C)OCCOCCOCCOc1ccnc(C(=O)C(C)C)c1 |
| InChI | InChI=1S/C18H29NO5/c1-14(2)18(20)17-13-16(5-6-19-17)24-12-10-22-8-7-21-9-11-23-15(3)4/h5-6,13-15H,7-12H2,1-4H3 |
| InChIKey | WMPUDDKTRMTTCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|