C19H30N2O3 — CID 169159368
1-[5-[1-[2-(2-propan-2-yloxyethoxy)ethyl]piperidin-4-yl]-2-pyridinyl]ethanone (PubChem CID 169159368) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[5-[1-[2-(2-propan-2-yloxyethoxy)ethyl]piperidin-4-yl]-2-pyridinyl]ethanone.
| Compound Name | 1-[5-[1-[2-(2-propan-2-yloxyethoxy)ethyl]piperidin-4-yl]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 169159368 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[5-[1-[2-(2-propan-2-yloxyethoxy)ethyl]piperidin-4-yl]-2-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(C2CCN(CCOCCOC(C)C)CC2)cn1 |
| InChI | InChI=1S/C19H30N2O3/c1-15(2)24-13-12-23-11-10-21-8-6-17(7-9-21)18-4-5-19(16(3)22)20-14-18/h4-5,14-15,17H,6-13H2,1-3H3 |
| InChIKey | VFONUHGAZWNYGE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|