C24H47NO4 — CID 169159418
1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide (PubChem CID 169159418) has the molecular formula C24H47NO4 and a molecular weight of 413.64 g/mol. Its IUPAC name is 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide.
| Compound Name | 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide |
|---|---|
| PubChem CID | 169159418 |
| Molecular Formula | C24H47NO4 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide |
| SMILES | CC.CCC(=O)C1CCCCC1.COCC1CCC(COCCCC(N)=O)CC1 |
| InChI | InChI=1S/C13H25NO3.C9H16O.C2H6/c1-16-9-11-4-6-12(7-5-11)10-17-8-2-3-13(14)15;1-2-9(10)8-6-4-3-5-7-8;1-2/h11-12H,2-10H2,1H3,(H2,14,15);8H,2-7H2,1H3;1-2H3 |
| InChIKey | BGAYSEDCTFZGBH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|