About 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide
1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide (PubChem CID 169159418) has the molecular formula C24H47NO4
and a molecular weight of 413.64 g/mol. Its IUPAC name is 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide.
Molecular Properties
| Compound Name | 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide |
| PubChem CID | 169159418 |
| Molecular Formula | C24H47NO4 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide |
| SMILES | CC.CCC(=O)C1CCCCC1.COCC1CCC(COCCCC(N)=O)CC1 |
| InChI | InChI=1S/C13H25NO3.C9H16O.C2H6/c1-16-9-11-4-6-12(7-5-11)10-17-8-2-3-13(14)15;1-2-9(10)8-6-4-3-5-7-8;1-2/h11-12H,2-10H2,1H3,(H2,14,15);8H,2-7H2,1H3;1-2H3 |
| InChIKey | BGAYSEDCTFZGBH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide?
The IUPAC name of 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide (CID 169159418) is 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide.
What is the SMILES notation for 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide?
The canonical SMILES for 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide is CC.CCC(=O)C1CCCCC1.COCC1CCC(COCCCC(N)=O)CC1.
What is the InChIKey of 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide?
The InChIKey is BGAYSEDCTFZGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3.C9H16O.C2H6/c1-16-9-11-4-6-12(7-5-11)10-17-8-2-3-13(14)15;1-2-9(10)8-6-4-3-5-7-8;1-2/h11-12H,2-10H2,1H3,(H2,14,15);8H,2-7H2,1H3;1-2H3.
What are the key properties of 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide?
1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide has a molecular weight of 413.64 g/mol, XLogP of 5.29, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpropan-1-one;ethane;4-[[4-(methoxymethyl)cyclohexyl]methoxy]butanamide is sourced from PubChem (CID 169159418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).